C15H21NO — CID 14813890
(3R)-3-methyl-1-[(1R)-1-phenylethyl]azepan-2-one (PubChem CID 14813890) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3R)-3-methyl-1-[(1R)-1-phenylethyl]azepan-2-one.
| Compound Name | (3R)-3-methyl-1-[(1R)-1-phenylethyl]azepan-2-one |
|---|---|
| PubChem CID | 14813890 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3R)-3-methyl-1-[(1R)-1-phenylethyl]azepan-2-one |
| SMILES | C[C@@H]1CCCCN([C@H](C)c2ccccc2)C1=O |
| InChI | InChI=1S/C15H21NO/c1-12-8-6-7-11-16(15(12)17)13(2)14-9-4-3-5-10-14/h3-5,9-10,12-13H,6-8,11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | HBAZQBDKVNZRDP-CHWSQXEVSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |