C22H30N3+ — CID 10738008
[1,3-bis[(1S)-1-phenylethyl]-1,3-diazinan-2-ylidene]-dimethylazanium (PubChem CID 10738008) has the molecular formula C22H30N3+ and a molecular weight of 336.50 g/mol. Its IUPAC name is [1,3-bis[(1S)-1-phenylethyl]-1,3-diazinan-2-ylidene]-dimethylazanium.
| Compound Name | [1,3-bis[(1S)-1-phenylethyl]-1,3-diazinan-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 10738008 |
| Molecular Formula | C22H30N3+ |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | [1,3-bis[(1S)-1-phenylethyl]-1,3-diazinan-2-ylidene]-dimethylazanium |
| SMILES | C[C@@H](c1ccccc1)N1CCCN([C@@H](C)c2ccccc2)C1=[N+](C)C |
| InChI | InChI=1S/C22H30N3/c1-18(20-12-7-5-8-13-20)24-16-11-17-25(22(24)23(3)4)19(2)21-14-9-6-10-15-21/h5-10,12-15,18-19H,11,16-17H2,1-4H3/q+1/t18-,19-/m0/s1 |
| InChIKey | GIARZLKINIEQQO-OALUTQOASA-N |
| XLogP | 4.14 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|