C13H21N2P — CID 130445088
1-(1-phenylethyl)-3-propan-2-yl-1,3,2-diazaphospholidine (PubChem CID 130445088) has the molecular formula C13H21N2P and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-propan-2-yl-1,3,2-diazaphospholidine.
| Compound Name | 1-(1-phenylethyl)-3-propan-2-yl-1,3,2-diazaphospholidine |
|---|---|
| PubChem CID | 130445088 |
| Molecular Formula | C13H21N2P |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(1-phenylethyl)-3-propan-2-yl-1,3,2-diazaphospholidine |
| SMILES | CC(C)N1CCN(C(C)c2ccccc2)P1 |
| InChI | InChI=1S/C13H21N2P/c1-11(2)14-9-10-15(16-14)12(3)13-7-5-4-6-8-13/h4-8,11-12,16H,9-10H2,1-3H3 |
| InChIKey | DAFAZGUFGRMCKE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|