C13H17N — CID 15468712
1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine (PubChem CID 15468712) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 15468712 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
| SMILES | C[C@H](c1ccccc1)N1CC=CCC1 |
| InChI | InChI=1S/C13H17N/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-6,8-9,12H,7,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | YMNCZVSNJMSDIK-GFCCVEGCSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|