C15H19NO2 — CID 72745116
[2-(3,6-dihydro-2H-pyridin-1-yl)-2-phenylethyl] acetate (PubChem CID 72745116) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [2-(3,6-dihydro-2H-pyridin-1-yl)-2-phenylethyl] acetate.
| Compound Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-2-phenylethyl] acetate |
|---|---|
| PubChem CID | 72745116 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-2-phenylethyl] acetate |
| SMILES | CC(=O)OCC(c1ccccc1)N1CC=CCC1 |
| InChI | InChI=1S/C15H19NO2/c1-13(17)18-12-15(14-8-4-2-5-9-14)16-10-6-3-7-11-16/h2-6,8-9,15H,7,10-12H2,1H3 |
| InChIKey | KSNRJOVJKRCYDB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|