C7H12BrN — CID 174278669
1-(1-bromoethyl)-3,6-dihydro-2H-pyridine (PubChem CID 174278669) has the molecular formula C7H12BrN and a molecular weight of 190.08 g/mol. Its IUPAC name is 1-(1-bromoethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(1-bromoethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 174278669 |
| Molecular Formula | C7H12BrN |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 1-(1-bromoethyl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(Br)N1CC=CCC1 |
| InChI | InChI=1S/C7H12BrN/c1-7(8)9-5-3-2-4-6-9/h2-3,7H,4-6H2,1H3 |
| InChIKey | VNYGVBGXQKBMHR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|