C9H15NO2 — CID 82364065
2-(3,6-dihydro-2H-pyridin-1-yl)butanoic acid (PubChem CID 82364065) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-yl)butanoic acid.
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 82364065 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1CC=CCC1 |
| InChI | InChI=1S/C9H15NO2/c1-2-8(9(11)12)10-6-4-3-5-7-10/h3-4,8H,2,5-7H2,1H3,(H,11,12) |
| InChIKey | OSIJBWJTJBWQBE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|