2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid

C10H17NO2 — CID 64681872

IUPAC2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid
SMILESCCC(C)C(C(=O)O)N1CC=CC1
InChIInChI=1S/C10H17NO2/c1-3-8(2)9(10(12)13)11-6-4-5-7-11/h4-5,8-9H,3,6-7H2,1-2H3,(H,12,13)
InChIKeyDKYGCIIGNNBNGY-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.36
Rot. Bonds4

About 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid

2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid (PubChem CID 64681872) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid.

Molecular Properties

Compound Name2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid
PubChem CID64681872
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid
SMILESCCC(C)C(C(=O)O)N1CC=CC1
InChIInChI=1S/C10H17NO2/c1-3-8(2)9(10(12)13)11-6-4-5-7-11/h4-5,8-9H,3,6-7H2,1-2H3,(H,12,13)
InChIKeyDKYGCIIGNNBNGY-UHFFFAOYSA-N
XLogP1.36
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid?
The IUPAC name of 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid (CID 64681872) is 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid.
What is the SMILES notation for 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid?
The canonical SMILES for 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid is CCC(C)C(C(=O)O)N1CC=CC1.
What is the InChIKey of 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid?
The InChIKey is DKYGCIIGNNBNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-8(2)9(10(12)13)11-6-4-5-7-11/h4-5,8-9H,3,6-7H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid?
2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid has a molecular weight of 183.25 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydropyrrol-1-yl)-3-methylpentanoic acid is sourced from PubChem (CID 64681872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).