C11H20N2 — CID 170255458
1-(1-propan-2-ylazetidin-3-yl)-3,6-dihydro-2H-pyridine (PubChem CID 170255458) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-(1-propan-2-ylazetidin-3-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(1-propan-2-ylazetidin-3-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 170255458 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-(1-propan-2-ylazetidin-3-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)N1CC(N2CC=CCC2)C1 |
| InChI | InChI=1S/C11H20N2/c1-10(2)13-8-11(9-13)12-6-4-3-5-7-12/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | UPXOTJRRXBIJMZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|