C10H18N2 — CID 174829694
1-[(3S)-piperidin-3-yl]-3,6-dihydro-2H-pyridine (PubChem CID 174829694) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-[(3S)-piperidin-3-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(3S)-piperidin-3-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 174829694 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-[(3S)-piperidin-3-yl]-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN([C@H]2CCCNC2)CC1 |
| InChI | InChI=1S/C10H18N2/c1-2-7-12(8-3-1)10-5-4-6-11-9-10/h1-2,10-11H,3-9H2/t10-/m0/s1 |
| InChIKey | WTXFCLXPBJCWHG-JTQLQIEISA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|