C7H15ClN2 — CID 71607215
(8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;hydrochloride (PubChem CID 71607215) has the molecular formula C7H15ClN2 and a molecular weight of 162.66 g/mol. Its IUPAC name is (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;hydrochloride.
| Compound Name | (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 71607215 |
| Molecular Formula | C7H15ClN2 |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;hydrochloride |
| SMILES | C1C[C@@H]2CNCCN2C1.Cl |
| InChI | InChI=1S/C7H14N2.ClH/c1-2-7-6-8-3-5-9(7)4-1;/h7-8H,1-6H2;1H/t7-;/m1./s1 |
| InChIKey | UMFVXZFBUOWRIS-OGFXRTJISA-N |
| XLogP | 0.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |