C6H13N3 — CID 22562213
1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyrazine (PubChem CID 22562213) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyrazine.
| Compound Name | 1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 22562213 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyrazine |
| SMILES | C1CN2CNCC2CN1 |
| InChI | InChI=1S/C6H13N3/c1-2-9-5-8-4-6(9)3-7-1/h6-8H,1-5H2 |
| InChIKey | DROWRQIHZCZNEW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |