C8H19Cl2N3 — CID 155822363
2-methyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine;dihydrochloride (PubChem CID 155822363) has the molecular formula C8H19Cl2N3 and a molecular weight of 228.17 g/mol. Its IUPAC name is 2-methyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine;dihydrochloride.
| Compound Name | 2-methyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 155822363 |
| Molecular Formula | C8H19Cl2N3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-methyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine;dihydrochloride |
| SMILES | CN1CCN2CCNCC2C1.Cl.Cl |
| InChI | InChI=1S/C8H17N3.2ClH/c1-10-4-5-11-3-2-9-6-8(11)7-10;;/h8-9H,2-7H2,1H3;2*1H |
| InChIKey | ZPQMFQLZTFXSEX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |