C8H16FN3 — CID 170582043
2-fluoro-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 170582043) has the molecular formula C8H16FN3 and a molecular weight of 173.23 g/mol. Its IUPAC name is 2-fluoro-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | 2-fluoro-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 170582043 |
| Molecular Formula | C8H16FN3 |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | 2-fluoro-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | CN1CCN2CCN(F)CC2C1 |
| InChI | InChI=1S/C8H16FN3/c1-10-2-3-11-4-5-12(9)7-8(11)6-10/h8H,2-7H2,1H3 |
| InChIKey | PBZPPMCUKBDXMU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|