C20H42N4 — CID 158552360
2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(1-methylpiperidine) (PubChem CID 158552360) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is 2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(1-methylpiperidine).
| Compound Name | 2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(1-methylpiperidine) |
|---|---|
| PubChem CID | 158552360 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | 2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(1-methylpiperidine) |
| SMILES | CN1CCCCC1.CN1CCCCC1.CN1CCN2CCCC2C1 |
| InChI | InChI=1S/C8H16N2.2C6H13N/c1-9-5-6-10-4-2-3-8(10)7-9;2*1-7-5-3-2-4-6-7/h8H,2-7H2,1H3;2*2-6H2,1H3 |
| InChIKey | HPWLKUMWHBYNJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |