C15H32N4 — CID 142374718
1-cyclopropyl-4-methylpiperazine;1,2,4-trimethylpiperazine (PubChem CID 142374718) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-cyclopropyl-4-methylpiperazine;1,2,4-trimethylpiperazine.
| Compound Name | 1-cyclopropyl-4-methylpiperazine;1,2,4-trimethylpiperazine |
|---|---|
| PubChem CID | 142374718 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1-cyclopropyl-4-methylpiperazine;1,2,4-trimethylpiperazine |
| SMILES | CC1CN(C)CCN1C.CN1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C8H16N2.C7H16N2/c1-9-4-6-10(7-5-9)8-2-3-8;1-7-6-8(2)4-5-9(7)3/h8H,2-7H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | DSHQJSGHAUIGRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |