C13H27N3 — CID 54054152
4,5-dimethyl-1-(1-methylpiperidin-4-yl)-1,4-diazepane (PubChem CID 54054152) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 4,5-dimethyl-1-(1-methylpiperidin-4-yl)-1,4-diazepane.
| Compound Name | 4,5-dimethyl-1-(1-methylpiperidin-4-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 54054152 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 4,5-dimethyl-1-(1-methylpiperidin-4-yl)-1,4-diazepane |
| SMILES | CC1CCN(C2CCN(C)CC2)CCN1C |
| InChI | InChI=1S/C13H27N3/c1-12-4-9-16(11-10-15(12)3)13-5-7-14(2)8-6-13/h12-13H,4-11H2,1-3H3 |
| InChIKey | LVAYIBBZCDFOPU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |