C19H44F2N4 — CID 177212485
6,6-difluoro-1,4-dimethyl-1,4-diazepane;ethane;1,4,5-trimethyl-1,4-diazepane (PubChem CID 177212485) has the molecular formula C19H44F2N4 and a molecular weight of 366.59 g/mol. Its IUPAC name is 6,6-difluoro-1,4-dimethyl-1,4-diazepane;ethane;1,4,5-trimethyl-1,4-diazepane.
| Compound Name | 6,6-difluoro-1,4-dimethyl-1,4-diazepane;ethane;1,4,5-trimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 177212485 |
| Molecular Formula | C19H44F2N4 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 6,6-difluoro-1,4-dimethyl-1,4-diazepane;ethane;1,4,5-trimethyl-1,4-diazepane |
| SMILES | CC.CC.CC1CCN(C)CCN1C.CN1CCN(C)CC(F)(F)C1 |
| InChI | InChI=1S/C8H18N2.C7H14F2N2.2C2H6/c1-8-4-5-9(2)6-7-10(8)3;1-10-3-4-11(2)6-7(8,9)5-10;2*1-2/h8H,4-7H2,1-3H3;3-6H2,1-2H3;2*1-2H3 |
| InChIKey | HYGWDUFJEJEXRY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |