C9H22N2 — CID 90960926
ethane;(2S)-1,2,4-trimethylpiperazine (PubChem CID 90960926) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is ethane;(2S)-1,2,4-trimethylpiperazine.
| Compound Name | ethane;(2S)-1,2,4-trimethylpiperazine |
|---|---|
| PubChem CID | 90960926 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | ethane;(2S)-1,2,4-trimethylpiperazine |
| SMILES | CC.C[C@H]1CN(C)CCN1C |
| InChI | InChI=1S/C7H16N2.C2H6/c1-7-6-8(2)4-5-9(7)3;1-2/h7H,4-6H2,1-3H3;1-2H3/t7-;/m0./s1 |
| InChIKey | JYVYFJZPMPAMHR-FJXQXJEOSA-N |
| XLogP | 1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |