C10H24N2 — CID 142283351
ethane;4-ethyl-1,2-dimethylpiperazine (PubChem CID 142283351) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is ethane;4-ethyl-1,2-dimethylpiperazine.
| Compound Name | ethane;4-ethyl-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 142283351 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | ethane;4-ethyl-1,2-dimethylpiperazine |
| SMILES | CC.CCN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C8H18N2.C2H6/c1-4-10-6-5-9(3)8(2)7-10;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | BZGPEZHHEWWHTJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |