C8H15N3 — CID 63610363
2-(3,4-dimethylpiperazin-1-yl)acetonitrile (PubChem CID 63610363) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(3,4-dimethylpiperazin-1-yl)acetonitrile.
| Compound Name | 2-(3,4-dimethylpiperazin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 63610363 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(3,4-dimethylpiperazin-1-yl)acetonitrile |
| SMILES | CC1CN(CC#N)CCN1C |
| InChI | InChI=1S/C8H15N3/c1-8-7-11(4-3-9)6-5-10(8)2/h8H,4-7H2,1-2H3 |
| InChIKey | OQFHXEBFZZKPGR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|