C10H22N2O — CID 166658455
(2S)-4-(3-methoxypropyl)-1,2-dimethylpiperazine (PubChem CID 166658455) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2S)-4-(3-methoxypropyl)-1,2-dimethylpiperazine.
| Compound Name | (2S)-4-(3-methoxypropyl)-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 166658455 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2S)-4-(3-methoxypropyl)-1,2-dimethylpiperazine |
| SMILES | COCCCN1CCN(C)[C@@H](C)C1 |
| InChI | InChI=1S/C10H22N2O/c1-10-9-12(5-4-8-13-3)7-6-11(10)2/h10H,4-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | QPLFAWAUBCRWHH-JTQLQIEISA-N |
| XLogP | 0.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|