C11H25N3 — CID 63608579
N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-1-amine (PubChem CID 63608579) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63608579 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H25N3/c1-4-5-12-6-7-14-9-8-13(3)11(2)10-14/h11-12H,4-10H2,1-3H3 |
| InChIKey | BJASZHHFNNGTJG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|