C13H29N3 — CID 63609305
N-[3-(3,4-dimethylpiperazin-1-yl)propyl]-2-methylpropan-1-amine (PubChem CID 63609305) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is N-[3-(3,4-dimethylpiperazin-1-yl)propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(3,4-dimethylpiperazin-1-yl)propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63609305 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N-[3-(3,4-dimethylpiperazin-1-yl)propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C13H29N3/c1-12(2)10-14-6-5-7-16-9-8-15(4)13(3)11-16/h12-14H,5-11H2,1-4H3 |
| InChIKey | KGTZFPPQBGYRPN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|