C15H33N3 — CID 63619609
4-(3,4-dimethylpiperazin-1-yl)-N-(2-methylpropyl)pentan-1-amine (PubChem CID 63619609) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 4-(3,4-dimethylpiperazin-1-yl)-N-(2-methylpropyl)pentan-1-amine.
| Compound Name | 4-(3,4-dimethylpiperazin-1-yl)-N-(2-methylpropyl)pentan-1-amine |
|---|---|
| PubChem CID | 63619609 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 4-(3,4-dimethylpiperazin-1-yl)-N-(2-methylpropyl)pentan-1-amine |
| SMILES | CC(C)CNCCCC(C)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C15H33N3/c1-13(2)11-16-8-6-7-14(3)18-10-9-17(5)15(4)12-18/h13-16H,6-12H2,1-5H3 |
| InChIKey | FKUCSSJZMQLTFZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|