C16H35N3 — CID 81469439
N,N,4-trimethyl-1-[5-(2-methylpropylamino)pentan-2-yl]pyrrolidin-3-amine (PubChem CID 81469439) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is N,N,4-trimethyl-1-[5-(2-methylpropylamino)pentan-2-yl]pyrrolidin-3-amine.
| Compound Name | N,N,4-trimethyl-1-[5-(2-methylpropylamino)pentan-2-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 81469439 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | N,N,4-trimethyl-1-[5-(2-methylpropylamino)pentan-2-yl]pyrrolidin-3-amine |
| SMILES | CC(C)CNCCCC(C)N1CC(C)C(N(C)C)C1 |
| InChI | InChI=1S/C16H35N3/c1-13(2)10-17-9-7-8-15(4)19-11-14(3)16(12-19)18(5)6/h13-17H,7-12H2,1-6H3 |
| InChIKey | PTEUDXHSZBGAON-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|