About N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine
N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine (PubChem CID 63609661) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine.
Analyze N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine (CID 63609661) is N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine is CC(C)NCCN1CCN(C)C(C)C1.
What is the InChIKey of N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine?
The InChIKey is CXWXXYNOTGBJDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3/c1-10(2)12-5-6-14-8-7-13(4)11(3)9-14/h10-12H,5-9H2,1-4H3.
What are the key properties of N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine?
N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine has a molecular weight of 199.34 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethylpiperazin-1-yl)ethyl]propan-2-amine is sourced from PubChem (CID 63609661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).