C15H31N3 — CID 55216809
N-(cyclohexylmethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine (PubChem CID 55216809) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine.
| Compound Name | N-(cyclohexylmethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 55216809 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
| SMILES | CC1CN(CCNCC2CCCCC2)CCN1C |
| InChI | InChI=1S/C15H31N3/c1-14-13-18(11-10-17(14)2)9-8-16-12-15-6-4-3-5-7-15/h14-16H,3-13H2,1-2H3 |
| InChIKey | RXFNBGMNCTWWMW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|