C14H31N3O — CID 55216424
N-(2-butoxyethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine (PubChem CID 55216424) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine.
| Compound Name | N-(2-butoxyethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 55216424 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N-(2-butoxyethyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
| SMILES | CCCCOCCNCCN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C14H31N3O/c1-4-5-11-18-12-7-15-6-8-17-10-9-16(3)14(2)13-17/h14-15H,4-13H2,1-3H3 |
| InChIKey | CNMUKWABUMBXAU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|