C17H35N3O — CID 81194356
N-(2-butoxyethyl)-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanamine (PubChem CID 81194356) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanamine.
| Compound Name | N-(2-butoxyethyl)-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanamine |
|---|---|
| PubChem CID | 81194356 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | N-(2-butoxyethyl)-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanamine |
| SMILES | CCCCOCCNCCN1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C17H35N3O/c1-3-4-13-21-14-9-18-8-12-20-11-7-17-16(15-20)6-5-10-19(17)2/h16-18H,3-15H2,1-2H3 |
| InChIKey | BQNKXCBQYZSRRG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|