C15H31N3 — CID 81197694
2-methyl-N-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethyl]propan-2-amine (PubChem CID 81197694) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-methyl-N-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 81197694 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-methyl-N-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethyl]propan-2-amine |
| SMILES | CN1CCCC2CN(CCNC(C)(C)C)CCC21 |
| InChI | InChI=1S/C15H31N3/c1-15(2,3)16-8-11-18-10-7-14-13(12-18)6-5-9-17(14)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | NATGSWWUSZSBKW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |