C11H25N3 — CID 65233149
2-[(3,4-dimethylpiperazin-1-yl)methyl]butan-1-amine (PubChem CID 65233149) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperazin-1-yl)methyl]butan-1-amine.
| Compound Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 65233149 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]butan-1-amine |
| SMILES | CCC(CN)CN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H25N3/c1-4-11(7-12)9-14-6-5-13(3)10(2)8-14/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | MBRREXWRLOJJAR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |