methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate

C12H25N3O2 — CID 63635767

IUPACmethyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate
SMILESCCNC(CN1CCN(C)C(C)C1)C(=O)OC
InChIInChI=1S/C12H25N3O2/c1-5-13-11(12(16)17-4)9-15-7-6-14(3)10(2)8-15/h10-11,13H,5-9H2,1-4H3
InChIKeyLMTYPPRCAQSAAL-UHFFFAOYSA-N
MW243.35 g/mol
LogP-0.23
Rot. Bonds5

About methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate

methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate (PubChem CID 63635767) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate.

Molecular Properties

Compound Namemethyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate
PubChem CID63635767
Molecular FormulaC12H25N3O2
Molecular Weight243.35 g/mol
Exact Mass243.19
IUPAC Namemethyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate
SMILESCCNC(CN1CCN(C)C(C)C1)C(=O)OC
InChIInChI=1S/C12H25N3O2/c1-5-13-11(12(16)17-4)9-15-7-6-14(3)10(2)8-15/h10-11,13H,5-9H2,1-4H3
InChIKeyLMTYPPRCAQSAAL-UHFFFAOYSA-N
XLogP-0.23
TPSA44.81 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.35
LogP ≤ 5-0.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate?
The IUPAC name of methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate (CID 63635767) is methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate.
What is the SMILES notation for methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate?
The canonical SMILES for methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate is CCNC(CN1CCN(C)C(C)C1)C(=O)OC.
What is the InChIKey of methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate?
The InChIKey is LMTYPPRCAQSAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-5-13-11(12(16)17-4)9-15-7-6-14(3)10(2)8-15/h10-11,13H,5-9H2,1-4H3.
What are the key properties of methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate?
methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate has a molecular weight of 243.35 g/mol, XLogP of -0.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dimethylpiperazin-1-yl)-2-(ethylamino)propanoate is sourced from PubChem (CID 63635767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).