C11H24N2 — CID 161379483
1,3-diethylazetidine;1,2-dimethylaziridine (PubChem CID 161379483) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1,3-diethylazetidine;1,2-dimethylaziridine.
| Compound Name | 1,3-diethylazetidine;1,2-dimethylaziridine |
|---|---|
| PubChem CID | 161379483 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1,3-diethylazetidine;1,2-dimethylaziridine |
| SMILES | CC1CN1C.CCC1CN(CC)C1 |
| InChI | InChI=1S/C7H15N.C4H9N/c1-3-7-5-8(4-2)6-7;1-4-3-5(4)2/h7H,3-6H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | VRNKZXJKGJWYJT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|