C12H30N2 — CID 142347964
ethane;(2R)-1,2,4-trimethyl-1,4-diazepane (PubChem CID 142347964) has the molecular formula C12H30N2 and a molecular weight of 202.39 g/mol. Its IUPAC name is ethane;(2R)-1,2,4-trimethyl-1,4-diazepane.
| Compound Name | ethane;(2R)-1,2,4-trimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 142347964 |
| Molecular Formula | C12H30N2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.24 |
| IUPAC Name | ethane;(2R)-1,2,4-trimethyl-1,4-diazepane |
| SMILES | CC.CC.C[C@@H]1CN(C)CCCN1C |
| InChI | InChI=1S/C8H18N2.2C2H6/c1-8-7-9(2)5-4-6-10(8)3;2*1-2/h8H,4-7H2,1-3H3;2*1-2H3/t8-;;/m1../s1 |
| InChIKey | LYFZCDMAGGVVFM-YCBDHFTFSA-N |
| XLogP | 2.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |