C9H21NO — CID 163257636
4,5-dimethyl-1,4-oxazepane;ethane (PubChem CID 163257636) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is 4,5-dimethyl-1,4-oxazepane;ethane.
| Compound Name | 4,5-dimethyl-1,4-oxazepane;ethane |
|---|---|
| PubChem CID | 163257636 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 4,5-dimethyl-1,4-oxazepane;ethane |
| SMILES | CC.CC1CCOCCN1C |
| InChI | InChI=1S/C7H15NO.C2H6/c1-7-3-5-9-6-4-8(7)2;1-2/h7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | ONFWKXIHVSROAF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |