About 4,5-dimethyl-1,4-oxazepane;ethane
4,5-dimethyl-1,4-oxazepane;ethane (PubChem CID 163257636) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is 4,5-dimethyl-1,4-oxazepane;ethane.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,4-oxazepane;ethane |
| PubChem CID | 163257636 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 4,5-dimethyl-1,4-oxazepane;ethane |
| SMILES | CC.CC1CCOCCN1C |
| InChI | InChI=1S/C7H15NO.C2H6/c1-7-3-5-9-6-4-8(7)2;1-2/h7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | ONFWKXIHVSROAF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-1,4-oxazepane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,4-oxazepane;ethane?
The IUPAC name of 4,5-dimethyl-1,4-oxazepane;ethane (CID 163257636) is 4,5-dimethyl-1,4-oxazepane;ethane.
What is the SMILES notation for 4,5-dimethyl-1,4-oxazepane;ethane?
The canonical SMILES for 4,5-dimethyl-1,4-oxazepane;ethane is CC.CC1CCOCCN1C.
What is the InChIKey of 4,5-dimethyl-1,4-oxazepane;ethane?
The InChIKey is ONFWKXIHVSROAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H6/c1-7-3-5-9-6-4-8(7)2;1-2/h7H,3-6H2,1-2H3;1-2H3.
What are the key properties of 4,5-dimethyl-1,4-oxazepane;ethane?
4,5-dimethyl-1,4-oxazepane;ethane has a molecular weight of 159.27 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,4-oxazepane;ethane is sourced from PubChem (CID 163257636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).