C15H36N2O2 — CID 145315669
3,4-dimethylmorpholine;ethane;4-methylmorpholine (PubChem CID 145315669) has the molecular formula C15H36N2O2 and a molecular weight of 276.46 g/mol. Its IUPAC name is 3,4-dimethylmorpholine;ethane;4-methylmorpholine.
| Compound Name | 3,4-dimethylmorpholine;ethane;4-methylmorpholine |
|---|---|
| PubChem CID | 145315669 |
| Molecular Formula | C15H36N2O2 |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 3,4-dimethylmorpholine;ethane;4-methylmorpholine |
| SMILES | CC.CC.CC1COCCN1C.CN1CCOCC1 |
| InChI | InChI=1S/C6H13NO.C5H11NO.2C2H6/c1-6-5-8-4-3-7(6)2;1-6-2-4-7-5-3-6;2*1-2/h6H,3-5H2,1-2H3;2-5H2,1H3;2*1-2H3 |
| InChIKey | KEIJHGPMOCVGGE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |