C17H42N2O2 — CID 172583303
3,4-dimethylmorpholine;ethane;2-methylmorpholine (PubChem CID 172583303) has the molecular formula C17H42N2O2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 3,4-dimethylmorpholine;ethane;2-methylmorpholine.
| Compound Name | 3,4-dimethylmorpholine;ethane;2-methylmorpholine |
|---|---|
| PubChem CID | 172583303 |
| Molecular Formula | C17H42N2O2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.32 |
| IUPAC Name | 3,4-dimethylmorpholine;ethane;2-methylmorpholine |
| SMILES | CC.CC.CC.CC1CNCCO1.CC1COCCN1C |
| InChI | InChI=1S/C6H13NO.C5H11NO.3C2H6/c1-6-5-8-4-3-7(6)2;1-5-4-6-2-3-7-5;3*1-2/h6H,3-5H2,1-2H3;5-6H,2-4H2,1H3;3*1-2H3 |
| InChIKey | DOEAZWPAZNVIQQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |