C8H20N2O — CID 178036626
ethane;4-methyl-1,4-oxazepan-6-amine (PubChem CID 178036626) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;4-methyl-1,4-oxazepan-6-amine.
| Compound Name | ethane;4-methyl-1,4-oxazepan-6-amine |
|---|---|
| PubChem CID | 178036626 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | ethane;4-methyl-1,4-oxazepan-6-amine |
| SMILES | CC.CN1CCOCC(N)C1 |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-8-2-3-9-5-6(7)4-8;1-2/h6H,2-5,7H2,1H3;1-2H3 |
| InChIKey | FLVKFJWZPZHDCG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |