C11H23NO — CID 164548076
ethane;7-methyl-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine (PubChem CID 164548076) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;7-methyl-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine.
| Compound Name | ethane;7-methyl-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine |
|---|---|
| PubChem CID | 164548076 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethane;7-methyl-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine |
| SMILES | CC.CN1CCC2CCOCC2C1 |
| InChI | InChI=1S/C9H17NO.C2H6/c1-10-4-2-8-3-5-11-7-9(8)6-10;1-2/h8-9H,2-7H2,1H3;1-2H3 |
| InChIKey | UZSMJGHGUCHQHY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |