About ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane
ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane (PubChem CID 145098920) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane.
Molecular Properties
| Compound Name | ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane |
| PubChem CID | 145098920 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane |
| SMILES | CC.CN1CCC2CCC3CCCC(C1)C32 |
| InChI | InChI=1S/C13H23N.C2H6/c1-14-8-7-11-6-5-10-3-2-4-12(9-14)13(10)11;1-2/h10-13H,2-9H2,1H3;1-2H3 |
| InChIKey | MHLILMBABROLTR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane?
The IUPAC name of ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane (CID 145098920) is ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane.
What is the SMILES notation for ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane?
The canonical SMILES for ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane is CC.CN1CCC2CCC3CCCC(C1)C32.
What is the InChIKey of ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane?
The InChIKey is MHLILMBABROLTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N.C2H6/c1-14-8-7-11-6-5-10-3-2-4-12(9-14)13(10)11;1-2/h10-13H,2-9H2,1H3;1-2H3.
What are the key properties of ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane?
ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane has a molecular weight of 223.40 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;10-methyl-10-azatricyclo[6.4.1.04,13]tridecane is sourced from PubChem (CID 145098920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).