C13H23N — CID 145098921
10-methyl-10-azatricyclo[6.4.1.04,13]tridecane (PubChem CID 145098921) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 10-methyl-10-azatricyclo[6.4.1.04,13]tridecane.
| Compound Name | 10-methyl-10-azatricyclo[6.4.1.04,13]tridecane |
|---|---|
| PubChem CID | 145098921 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 10-methyl-10-azatricyclo[6.4.1.04,13]tridecane |
| SMILES | CN1CCC2CCC3CCCC(C1)C32 |
| InChI | InChI=1S/C13H23N/c1-14-8-7-11-6-5-10-3-2-4-12(9-14)13(10)11/h10-13H,2-9H2,1H3 |
| InChIKey | XECCMNUSSSHHLX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |