C10H18BrN — CID 7164445
(4aS,6R,8aR)-6-bromo-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 7164445) has the molecular formula C10H18BrN and a molecular weight of 232.16 g/mol. Its IUPAC name is (4aS,6R,8aR)-6-bromo-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | (4aS,6R,8aR)-6-bromo-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 7164445 |
| Molecular Formula | C10H18BrN |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (4aS,6R,8aR)-6-bromo-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | CN1CC[C@H]2C[C@H](Br)CC[C@H]2C1 |
| InChI | InChI=1S/C10H18BrN/c1-12-5-4-8-6-10(11)3-2-9(8)7-12/h8-10H,2-7H2,1H3/t8-,9-,10+/m0/s1 |
| InChIKey | FQFNYAKOZPURLX-LPEHRKFASA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|