About ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde
ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde (PubChem CID 168940768) has the molecular formula C14H32N2O2
and a molecular weight of 260.42 g/mol. Its IUPAC name is ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde.
Molecular Properties
| Compound Name | ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde |
| PubChem CID | 168940768 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde |
| SMILES | CC.CC.CC1COCCN1C=O.CN1CCC1 |
| InChI | InChI=1S/C6H11NO2.C4H9N.2C2H6/c1-6-4-9-3-2-7(6)5-8;1-5-3-2-4-5;2*1-2/h5-6H,2-4H2,1H3;2-4H2,1H3;2*1-2H3 |
| InChIKey | IYPWAHAWMBWQML-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde?
The IUPAC name of ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde (CID 168940768) is ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde.
What is the SMILES notation for ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde?
The canonical SMILES for ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde is CC.CC.CC1COCCN1C=O.CN1CCC1.
What is the InChIKey of ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde?
The InChIKey is IYPWAHAWMBWQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C4H9N.2C2H6/c1-6-4-9-3-2-7(6)5-8;1-5-3-2-4-5;2*1-2/h5-6H,2-4H2,1H3;2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde?
ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde has a molecular weight of 260.42 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylazetidine;3-methylmorpholine-4-carbaldehyde is sourced from PubChem (CID 168940768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).