About 4-fluoro-1-methylpiperidine;4-methylmorpholine
4-fluoro-1-methylpiperidine;4-methylmorpholine (PubChem CID 153371912) has the molecular formula C11H23FN2O
and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-fluoro-1-methylpiperidine;4-methylmorpholine.
Molecular Properties
| Compound Name | 4-fluoro-1-methylpiperidine;4-methylmorpholine |
| PubChem CID | 153371912 |
| Molecular Formula | C11H23FN2O |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-fluoro-1-methylpiperidine;4-methylmorpholine |
| SMILES | CN1CCC(F)CC1.CN1CCOCC1 |
| InChI | InChI=1S/C6H12FN.C5H11NO/c1-8-4-2-6(7)3-5-8;1-6-2-4-7-5-3-6/h6H,2-5H2,1H3;2-5H2,1H3 |
| InChIKey | ZGSMXHGFFMCSQK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-1-methylpiperidine;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methylpiperidine;4-methylmorpholine?
The IUPAC name of 4-fluoro-1-methylpiperidine;4-methylmorpholine (CID 153371912) is 4-fluoro-1-methylpiperidine;4-methylmorpholine.
What is the SMILES notation for 4-fluoro-1-methylpiperidine;4-methylmorpholine?
The canonical SMILES for 4-fluoro-1-methylpiperidine;4-methylmorpholine is CN1CCC(F)CC1.CN1CCOCC1.
What is the InChIKey of 4-fluoro-1-methylpiperidine;4-methylmorpholine?
The InChIKey is ZGSMXHGFFMCSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FN.C5H11NO/c1-8-4-2-6(7)3-5-8;1-6-2-4-7-5-3-6/h6H,2-5H2,1H3;2-5H2,1H3.
What are the key properties of 4-fluoro-1-methylpiperidine;4-methylmorpholine?
4-fluoro-1-methylpiperidine;4-methylmorpholine has a molecular weight of 218.32 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methylpiperidine;4-methylmorpholine is sourced from PubChem (CID 153371912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).