About (6R)-6-fluoro-3-methyl-1,3-oxazocane
(6R)-6-fluoro-3-methyl-1,3-oxazocane (PubChem CID 138637089) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is (6R)-6-fluoro-3-methyl-1,3-oxazocane.
Molecular Properties
| Compound Name | (6R)-6-fluoro-3-methyl-1,3-oxazocane |
| PubChem CID | 138637089 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | (6R)-6-fluoro-3-methyl-1,3-oxazocane |
| SMILES | CN1CC[C@@H](F)CCOC1 |
| InChI | InChI=1S/C7H14FNO/c1-9-4-2-7(8)3-5-10-6-9/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | FTFVKACYGSIDLV-SSDOTTSWSA-N |
| XLogP | 1.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-fluoro-3-methyl-1,3-oxazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-fluoro-3-methyl-1,3-oxazocane?
The IUPAC name of (6R)-6-fluoro-3-methyl-1,3-oxazocane (CID 138637089) is (6R)-6-fluoro-3-methyl-1,3-oxazocane.
What is the SMILES notation for (6R)-6-fluoro-3-methyl-1,3-oxazocane?
The canonical SMILES for (6R)-6-fluoro-3-methyl-1,3-oxazocane is CN1CC[C@@H](F)CCOC1.
What is the InChIKey of (6R)-6-fluoro-3-methyl-1,3-oxazocane?
The InChIKey is FTFVKACYGSIDLV-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H14FNO/c1-9-4-2-7(8)3-5-10-6-9/h7H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of (6R)-6-fluoro-3-methyl-1,3-oxazocane?
(6R)-6-fluoro-3-methyl-1,3-oxazocane has a molecular weight of 147.19 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-fluoro-3-methyl-1,3-oxazocane is sourced from PubChem (CID 138637089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).