About (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane
(3S)-3-fluoro-1-methylpyrrolidine;methoxyethane (PubChem CID 166533777) has the molecular formula C8H18FNO
and a molecular weight of 163.24 g/mol. Its IUPAC name is (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane.
Molecular Properties
| Compound Name | (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane |
| PubChem CID | 166533777 |
| Molecular Formula | C8H18FNO |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane |
| SMILES | CCOC.CN1CC[C@H](F)C1 |
| InChI | InChI=1S/C5H10FN.C3H8O/c1-7-3-2-5(6)4-7;1-3-4-2/h5H,2-4H2,1H3;3H2,1-2H3/t5-;/m0./s1 |
| InChIKey | FMEKOYUPYYOUEP-JEDNCBNOSA-N |
| XLogP | 1.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane?
The IUPAC name of (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane (CID 166533777) is (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane.
What is the SMILES notation for (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane?
The canonical SMILES for (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane is CCOC.CN1CC[C@H](F)C1.
What is the InChIKey of (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane?
The InChIKey is FMEKOYUPYYOUEP-JEDNCBNOSA-N. The full InChI is InChI=1S/C5H10FN.C3H8O/c1-7-3-2-5(6)4-7;1-3-4-2/h5H,2-4H2,1H3;3H2,1-2H3/t5-;/m0./s1.
What are the key properties of (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane?
(3S)-3-fluoro-1-methylpyrrolidine;methoxyethane has a molecular weight of 163.24 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-fluoro-1-methylpyrrolidine;methoxyethane is sourced from PubChem (CID 166533777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).