C9H21NO — CID 168995802
(3R)-1,3-dimethylpyrrolidine;methoxyethane (PubChem CID 168995802) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is (3R)-1,3-dimethylpyrrolidine;methoxyethane.
| Compound Name | (3R)-1,3-dimethylpyrrolidine;methoxyethane |
|---|---|
| PubChem CID | 168995802 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (3R)-1,3-dimethylpyrrolidine;methoxyethane |
| SMILES | CCOC.C[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C6H13N.C3H8O/c1-6-3-4-7(2)5-6;1-3-4-2/h6H,3-5H2,1-2H3;3H2,1-2H3/t6-;/m1./s1 |
| InChIKey | ZCVTXQCWWKRUSY-FYZOBXCZSA-N |
| XLogP | 1.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |