C8H19N — CID 90814408
(3R)-1,3-dimethylpyrrolidine;ethane (PubChem CID 90814408) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is (3R)-1,3-dimethylpyrrolidine;ethane.
| Compound Name | (3R)-1,3-dimethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 90814408 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | (3R)-1,3-dimethylpyrrolidine;ethane |
| SMILES | CC.C[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C6H13N.C2H6/c1-6-3-4-7(2)5-6;1-2/h6H,3-5H2,1-2H3;1-2H3/t6-;/m1./s1 |
| InChIKey | BTZAFKCAMMCRQD-FYZOBXCZSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |