C13H22N2 — CID 177054040
1,3-dimethylpyrrolidine;5-ethenyl-2-methyl-2H-pyrrole (PubChem CID 177054040) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine;5-ethenyl-2-methyl-2H-pyrrole.
| Compound Name | 1,3-dimethylpyrrolidine;5-ethenyl-2-methyl-2H-pyrrole |
|---|---|
| PubChem CID | 177054040 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1,3-dimethylpyrrolidine;5-ethenyl-2-methyl-2H-pyrrole |
| SMILES | C=CC1=NC(C)C=C1.CC1CCN(C)C1 |
| InChI | InChI=1S/C7H9N.C6H13N/c1-3-7-5-4-6(2)8-7;1-6-3-4-7(2)5-6/h3-6H,1H2,2H3;6H,3-5H2,1-2H3 |
| InChIKey | CLJRLIFANVTAAH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |